C19H30N4O4 — CID 146637688
2-[[(2R)-2-amino-2-[[(2S)-3-methyl-2-(methylamino)pentanoyl]amino]acetyl]-methylamino]-3-phenylpropanoic acid (PubChem CID 146637688) has the molecular formula C19H30N4O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2-[[(2R)-2-amino-2-[[(2S)-3-methyl-2-(methylamino)pentanoyl]amino]acetyl]-methylamino]-3-phenylpropanoic acid.
| Compound Name | 2-[[(2R)-2-amino-2-[[(2S)-3-methyl-2-(methylamino)pentanoyl]amino]acetyl]-methylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 146637688 |
| Molecular Formula | C19H30N4O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 2-[[(2R)-2-amino-2-[[(2S)-3-methyl-2-(methylamino)pentanoyl]amino]acetyl]-methylamino]-3-phenylpropanoic acid |
| SMILES | CCC(C)[C@H](NC)C(=O)N[C@@H](N)C(=O)N(C)C(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H30N4O4/c1-5-12(2)15(21-3)17(24)22-16(20)18(25)23(4)14(19(26)27)11-13-9-7-6-8-10-13/h6-10,12,14-16,21H,5,11,20H2,1-4H3,(H,22,24)(H,26,27)/t12?,14?,15-,16+/m0/s1 |
| InChIKey | PZFCQSULBWIHFP-DISOXQEGSA-N |
| XLogP | 0.18 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|