C31H31N3OS — CID 146637707
1'-[[4-(4-tert-butylphenyl)isoquinolin-3-yl]methyl]-1-methylsulfanylspiro[azetidine-3,3'-indole]-2'-one (PubChem CID 146637707) has the molecular formula C31H31N3OS and a molecular weight of 493.68 g/mol. Its IUPAC name is 1'-[[4-(4-tert-butylphenyl)isoquinolin-3-yl]methyl]-1-methylsulfanylspiro[azetidine-3,3'-indole]-2'-one.
| Compound Name | 1'-[[4-(4-tert-butylphenyl)isoquinolin-3-yl]methyl]-1-methylsulfanylspiro[azetidine-3,3'-indole]-2'-one |
|---|---|
| PubChem CID | 146637707 |
| Molecular Formula | C31H31N3OS |
| Molecular Weight | 493.68 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 1'-[[4-(4-tert-butylphenyl)isoquinolin-3-yl]methyl]-1-methylsulfanylspiro[azetidine-3,3'-indole]-2'-one |
| SMILES | CSN1CC2(C1)C(=O)N(Cc1ncc3ccccc3c1-c1ccc(C(C)(C)C)cc1)c1ccccc12 |
| InChI | InChI=1S/C31H31N3OS/c1-30(2,3)23-15-13-21(14-16-23)28-24-10-6-5-9-22(24)17-32-26(28)18-34-27-12-8-7-11-25(27)31(29(34)35)19-33(20-31)36-4/h5-17H,18-20H2,1-4H3 |
| InChIKey | UVQFNKRYNHEDCA-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.68 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|