C28H28N2O6S2 — CID 146638004
[3-(benzenesulfonyloxy)-2-methyl-2-pyridin-2-ylpropyl] 4-[3-(aminomethyl)phenyl]benzenesulfonate (PubChem CID 146638004) has the molecular formula C28H28N2O6S2 and a molecular weight of 552.67 g/mol. Its IUPAC name is [3-(benzenesulfonyloxy)-2-methyl-2-pyridin-2-ylpropyl] 4-[3-(aminomethyl)phenyl]benzenesulfonate.
| Compound Name | [3-(benzenesulfonyloxy)-2-methyl-2-pyridin-2-ylpropyl] 4-[3-(aminomethyl)phenyl]benzenesulfonate |
|---|---|
| PubChem CID | 146638004 |
| Molecular Formula | C28H28N2O6S2 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | [3-(benzenesulfonyloxy)-2-methyl-2-pyridin-2-ylpropyl] 4-[3-(aminomethyl)phenyl]benzenesulfonate |
| SMILES | CC(COS(=O)(=O)c1ccccc1)(COS(=O)(=O)c1ccc(-c2cccc(CN)c2)cc1)c1ccccn1 |
| InChI | InChI=1S/C28H28N2O6S2/c1-28(27-12-5-6-17-30-27,20-35-37(31,32)25-10-3-2-4-11-25)21-36-38(33,34)26-15-13-23(14-16-26)24-9-7-8-22(18-24)19-29/h2-18H,19-21,29H2,1H3 |
| InChIKey | LPUNGAZOEDSIIW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 125.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|