C24H27N3O3 — CID 146641445
(2E)-2-[[methyl-[(4-methylphenyl)methyl]amino]methylidene]-N-[(3S)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]but-3-enamide (PubChem CID 146641445) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is (2E)-2-[[methyl-[(4-methylphenyl)methyl]amino]methylidene]-N-[(3S)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]but-3-enamide.
| Compound Name | (2E)-2-[[methyl-[(4-methylphenyl)methyl]amino]methylidene]-N-[(3S)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]but-3-enamide |
|---|---|
| PubChem CID | 146641445 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | (2E)-2-[[methyl-[(4-methylphenyl)methyl]amino]methylidene]-N-[(3S)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]but-3-enamide |
| SMILES | C=C/C(=C\N(C)Cc1ccc(C)cc1)C(=O)N[C@H]1COc2ccccc2N(C)C1=O |
| InChI | InChI=1S/C24H27N3O3/c1-5-19(15-26(3)14-18-12-10-17(2)11-13-18)23(28)25-20-16-30-22-9-7-6-8-21(22)27(4)24(20)29/h5-13,15,20H,1,14,16H2,2-4H3,(H,25,28)/b19-15+/t20-/m0/s1 |
| InChIKey | KQDGRYJWOZAHSZ-ZAQQZEBGSA-N |
| XLogP | 3.04 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|