C29H26N4 — CID 146643118
4-[1-(4-amino-3-phenylphenyl)-2-(1H-imidazol-5-yl)ethyl]-2-phenylaniline (PubChem CID 146643118) has the molecular formula C29H26N4 and a molecular weight of 430.56 g/mol. Its IUPAC name is 4-[1-(4-amino-3-phenylphenyl)-2-(1H-imidazol-5-yl)ethyl]-2-phenylaniline.
| Compound Name | 4-[1-(4-amino-3-phenylphenyl)-2-(1H-imidazol-5-yl)ethyl]-2-phenylaniline |
|---|---|
| PubChem CID | 146643118 |
| Molecular Formula | C29H26N4 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 4-[1-(4-amino-3-phenylphenyl)-2-(1H-imidazol-5-yl)ethyl]-2-phenylaniline |
| SMILES | Nc1ccc(C(Cc2cnc[nH]2)c2ccc(N)c(-c3ccccc3)c2)cc1-c1ccccc1 |
| InChI | InChI=1S/C29H26N4/c30-28-13-11-22(15-26(28)20-7-3-1-4-8-20)25(17-24-18-32-19-33-24)23-12-14-29(31)27(16-23)21-9-5-2-6-10-21/h1-16,18-19,25H,17,30-31H2,(H,32,33) |
| InChIKey | YCQLBDOHKKUWIG-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|