C13H15N3 — CID 10353167
N-[(2R)-1-(1H-imidazol-5-yl)propan-2-yl]-1-phenylmethanimine (PubChem CID 10353167) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is N-[(2R)-1-(1H-imidazol-5-yl)propan-2-yl]-1-phenylmethanimine.
| Compound Name | N-[(2R)-1-(1H-imidazol-5-yl)propan-2-yl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 10353167 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | N-[(2R)-1-(1H-imidazol-5-yl)propan-2-yl]-1-phenylmethanimine |
| SMILES | C[C@H](Cc1cnc[nH]1)/N=C/c1ccccc1 |
| InChI | InChI=1S/C13H15N3/c1-11(7-13-9-14-10-16-13)15-8-12-5-3-2-4-6-12/h2-6,8-11H,7H2,1H3,(H,14,16)/b15-8+/t11-/m1/s1 |
| InChIKey | IIHOXWCZFPPWOZ-OXFWXOROSA-N |
| XLogP | 2.46 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|