C6H11ClN3- — CID 53313193
(2R)-1-(1H-imidazol-5-yl)propan-2-amine chloride (PubChem CID 53313193) has the molecular formula C6H11ClN3- and a molecular weight of 160.63 g/mol. Its IUPAC name is (2R)-1-(1H-imidazol-5-yl)propan-2-amine chloride.
| Compound Name | (2R)-1-(1H-imidazol-5-yl)propan-2-amine chloride |
|---|---|
| PubChem CID | 53313193 |
| Molecular Formula | C6H11ClN3- |
| Molecular Weight | 160.63 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | (2R)-1-(1H-imidazol-5-yl)propan-2-amine chloride |
| SMILES | C[C@@H](N)Cc1cnc[nH]1.[Cl-] |
| InChI | InChI=1S/C6H11N3.ClH/c1-5(7)2-6-3-8-4-9-6;/h3-5H,2,7H2,1H3,(H,8,9);1H/p-1/t5-;/m1./s1 |
| InChIKey | XGAQKLNTQVMPCP-NUBCRITNSA-M |
| XLogP | -2.70 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.63 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |