C8H13N3 — CID 126613398
(2S)-1-(1H-imidazol-5-yl)-3-methylbut-3-en-2-amine (PubChem CID 126613398) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is (2S)-1-(1H-imidazol-5-yl)-3-methylbut-3-en-2-amine.
| Compound Name | (2S)-1-(1H-imidazol-5-yl)-3-methylbut-3-en-2-amine |
|---|---|
| PubChem CID | 126613398 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | (2S)-1-(1H-imidazol-5-yl)-3-methylbut-3-en-2-amine |
| SMILES | C=C(C)[C@@H](N)Cc1cnc[nH]1 |
| InChI | InChI=1S/C8H13N3/c1-6(2)8(9)3-7-4-10-5-11-7/h4-5,8H,1,3,9H2,2H3,(H,10,11)/t8-/m0/s1 |
| InChIKey | AOMCPJNWXQKZJS-QMMMGPOBSA-N |
| XLogP | 0.86 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|