C6H9N3S2 — CID 174454561
2-amino-3-(1H-imidazol-5-yl)propanedithioic acid (PubChem CID 174454561) has the molecular formula C6H9N3S2 and a molecular weight of 187.29 g/mol. Its IUPAC name is 2-amino-3-(1H-imidazol-5-yl)propanedithioic acid.
| Compound Name | 2-amino-3-(1H-imidazol-5-yl)propanedithioic acid |
|---|---|
| PubChem CID | 174454561 |
| Molecular Formula | C6H9N3S2 |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.02 |
| IUPAC Name | 2-amino-3-(1H-imidazol-5-yl)propanedithioic acid |
| SMILES | NC(Cc1cnc[nH]1)C(=S)S |
| InChI | InChI=1S/C6H9N3S2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11) |
| InChIKey | LPGLVEVXFMNGFD-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|