C9H17ClN4O4S — CID 174889711
(2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;2-amino-3-sulfanylpropanoic acid;hydrochloride (PubChem CID 174889711) has the molecular formula C9H17ClN4O4S and a molecular weight of 312.78 g/mol. Its IUPAC name is (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;2-amino-3-sulfanylpropanoic acid;hydrochloride.
| Compound Name | (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;2-amino-3-sulfanylpropanoic acid;hydrochloride |
|---|---|
| PubChem CID | 174889711 |
| Molecular Formula | C9H17ClN4O4S |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;2-amino-3-sulfanylpropanoic acid;hydrochloride |
| SMILES | Cl.NC(CS)C(=O)O.N[C@@H](Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C6H9N3O2.C3H7NO2S.ClH/c7-5(6(10)11)1-4-2-8-3-9-4;4-2(1-7)3(5)6;/h2-3,5H,1,7H2,(H,8,9)(H,10,11);2,7H,1,4H2,(H,5,6);1H/t5-;;/m0../s1 |
| InChIKey | AVSIMFRAOLZRSS-XRIGFGBMSA-N |
| XLogP | -0.89 |
| TPSA | 155.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|