C9H16N4O4SZn — CID 87277729
(2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;(2R)-2-amino-3-sulfanylpropanoic acid;zinc (PubChem CID 87277729) has the molecular formula C9H16N4O4SZn and a molecular weight of 341.71 g/mol. Its IUPAC name is (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;(2R)-2-amino-3-sulfanylpropanoic acid;zinc.
| Compound Name | (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;(2R)-2-amino-3-sulfanylpropanoic acid;zinc |
|---|---|
| PubChem CID | 87277729 |
| Molecular Formula | C9H16N4O4SZn |
| Molecular Weight | 341.71 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;(2R)-2-amino-3-sulfanylpropanoic acid;zinc |
| SMILES | N[C@@H](CS)C(=O)O.N[C@@H](Cc1cnc[nH]1)C(=O)O.[Zn] |
| InChI | InChI=1S/C6H9N3O2.C3H7NO2S.Zn/c7-5(6(10)11)1-4-2-8-3-9-4;4-2(1-7)3(5)6;/h2-3,5H,1,7H2,(H,8,9)(H,10,11);2,7H,1,4H2,(H,5,6);/t5-;2-;/m00./s1 |
| InChIKey | SWDIYSZNENWWFE-GDOBSTBCSA-N |
| XLogP | -1.31 |
| TPSA | 155.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.71 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|