C13H29N3O — CID 177242295
3-amino-4-(1H-imidazol-5-yl)butan-2-one;ethane (PubChem CID 177242295) has the molecular formula C13H29N3O and a molecular weight of 243.39 g/mol. Its IUPAC name is 3-amino-4-(1H-imidazol-5-yl)butan-2-one;ethane.
| Compound Name | 3-amino-4-(1H-imidazol-5-yl)butan-2-one;ethane |
|---|---|
| PubChem CID | 177242295 |
| Molecular Formula | C13H29N3O |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.23 |
| IUPAC Name | 3-amino-4-(1H-imidazol-5-yl)butan-2-one;ethane |
| SMILES | CC.CC.CC.CC(=O)C(N)Cc1cnc[nH]1 |
| InChI | InChI=1S/C7H11N3O.3C2H6/c1-5(11)7(8)2-6-3-9-4-10-6;3*1-2/h3-4,7H,2,8H2,1H3,(H,9,10);3*1-2H3 |
| InChIKey | PTEPVIZHRPMHJX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |