C10H19N3O — CID 168886358
2-amino-1-(1H-imidazol-5-yl)pentan-3-one;ethane (PubChem CID 168886358) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-amino-1-(1H-imidazol-5-yl)pentan-3-one;ethane.
| Compound Name | 2-amino-1-(1H-imidazol-5-yl)pentan-3-one;ethane |
|---|---|
| PubChem CID | 168886358 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 2-amino-1-(1H-imidazol-5-yl)pentan-3-one;ethane |
| SMILES | CC.CCC(=O)C(N)Cc1cnc[nH]1 |
| InChI | InChI=1S/C8H13N3O.C2H6/c1-2-8(12)7(9)3-6-4-10-5-11-6;1-2/h4-5,7H,2-3,9H2,1H3,(H,10,11);1-2H3 |
| InChIKey | GGSFCNOZMLHREA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |