C12H18N4O4 — CID 71163498
(3S)-3-amino-4-[[(2S)-1-(1H-imidazol-5-yl)-3-oxopentan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 71163498) has the molecular formula C12H18N4O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is (3S)-3-amino-4-[[(2S)-1-(1H-imidazol-5-yl)-3-oxopentan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-[[(2S)-1-(1H-imidazol-5-yl)-3-oxopentan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 71163498 |
| Molecular Formula | C12H18N4O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (3S)-3-amino-4-[[(2S)-1-(1H-imidazol-5-yl)-3-oxopentan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CCC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@@H](N)CC(=O)O |
| InChI | InChI=1S/C12H18N4O4/c1-2-10(17)9(3-7-5-14-6-15-7)16-12(20)8(13)4-11(18)19/h5-6,8-9H,2-4,13H2,1H3,(H,14,15)(H,16,20)(H,18,19)/t8-,9-/m0/s1 |
| InChIKey | IIOVSIVXJQTXMA-IUCAKERBSA-N |
| XLogP | -0.78 |
| TPSA | 138.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |