C9H16N2 — CID 149460105
5-(2,3-dimethylbutyl)-1H-imidazole (PubChem CID 149460105) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 5-(2,3-dimethylbutyl)-1H-imidazole.
| Compound Name | 5-(2,3-dimethylbutyl)-1H-imidazole |
|---|---|
| PubChem CID | 149460105 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 5-(2,3-dimethylbutyl)-1H-imidazole |
| SMILES | CC(C)C(C)Cc1cnc[nH]1 |
| InChI | InChI=1S/C9H16N2/c1-7(2)8(3)4-9-5-10-6-11-9/h5-8H,4H2,1-3H3,(H,10,11) |
| InChIKey | YZINYQUNGZJSIP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |