C9H14N3O — CID 59432002
CID 59432002 (PubChem CID 59432002) has the molecular formula C9H14N3O and a molecular weight of 180.23 g/mol.
| Compound Name | CID 59432002 |
|---|---|
| PubChem CID | 59432002 |
| Molecular Formula | C9H14N3O |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | — |
| SMILES | CC(C)C(=O)[C@@H]([NH])Cc1cnc[nH]1 |
| InChI | InChI=1S/C9H14N3O/c1-6(2)9(13)8(10)3-7-4-11-5-12-7/h4-6,8,10H,3H2,1-2H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | BTVBMBUKACRZBG-QMMMGPOBSA-N |
| XLogP | 0.83 |
| TPSA | 69.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |