C7H13N3O — CID 123261764
3-amino-4-(1H-imidazol-5-yl)butan-2-ol (PubChem CID 123261764) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is 3-amino-4-(1H-imidazol-5-yl)butan-2-ol.
| Compound Name | 3-amino-4-(1H-imidazol-5-yl)butan-2-ol |
|---|---|
| PubChem CID | 123261764 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 3-amino-4-(1H-imidazol-5-yl)butan-2-ol |
| SMILES | CC(O)C(N)Cc1cnc[nH]1 |
| InChI | InChI=1S/C7H13N3O/c1-5(11)7(8)2-6-3-9-4-10-6/h3-5,7,11H,2,8H2,1H3,(H,9,10) |
| InChIKey | ZBQFFAQGWFSLST-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |