C9H18N3O2+ — CID 140599544
[1,1-dihydroxy-3-(1H-imidazol-5-yl)propan-2-yl]-trimethylazanium (PubChem CID 140599544) has the molecular formula C9H18N3O2+ and a molecular weight of 200.26 g/mol. Its IUPAC name is [1,1-dihydroxy-3-(1H-imidazol-5-yl)propan-2-yl]-trimethylazanium.
| Compound Name | [1,1-dihydroxy-3-(1H-imidazol-5-yl)propan-2-yl]-trimethylazanium |
|---|---|
| PubChem CID | 140599544 |
| Molecular Formula | C9H18N3O2+ |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | [1,1-dihydroxy-3-(1H-imidazol-5-yl)propan-2-yl]-trimethylazanium |
| SMILES | C[N+](C)(C)C(Cc1cnc[nH]1)C(O)O |
| InChI | InChI=1S/C9H18N3O2/c1-12(2,3)8(9(13)14)4-7-5-10-6-11-7/h5-6,8-9,13-14H,4H2,1-3H3,(H,10,11)/q+1 |
| InChIKey | VEEDHSSBZSCJQO-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|