C9H15N3O2 — CID 139025365
2-[dimethyl(trideuteriomethyl)azaniumyl]-3-(1H-imidazol-5-yl)propanoate (PubChem CID 139025365) has the molecular formula C9H15N3O2 and a molecular weight of 200.26 g/mol. Its IUPAC name is 2-[dimethyl(trideuteriomethyl)azaniumyl]-3-(1H-imidazol-5-yl)propanoate.
| Compound Name | 2-[dimethyl(trideuteriomethyl)azaniumyl]-3-(1H-imidazol-5-yl)propanoate |
|---|---|
| PubChem CID | 139025365 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 2-[dimethyl(trideuteriomethyl)azaniumyl]-3-(1H-imidazol-5-yl)propanoate |
| SMILES | [2H]C([2H])([2H])[N+](C)(C)C(Cc1cnc[nH]1)C(=O)[O-] |
| InChI | InChI=1S/C9H15N3O2/c1-12(2,3)8(9(13)14)4-7-5-10-6-11-7/h5-6,8H,4H2,1-3H3,(H-,10,11,13,14)/i1D3 |
| InChIKey | GPPYTCRVKHULJH-FIBGUPNXSA-N |
| XLogP | -1.22 |
| TPSA | 68.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|