C10H14N4Na2O4 — CID 172697664
disodium;2,2-diamino-4-(1H-imidazol-5-ylmethyl)-3-methylpentanedioate (PubChem CID 172697664) has the molecular formula C10H14N4Na2O4 and a molecular weight of 300.23 g/mol. Its IUPAC name is disodium;2,2-diamino-4-(1H-imidazol-5-ylmethyl)-3-methylpentanedioate.
| Compound Name | disodium;2,2-diamino-4-(1H-imidazol-5-ylmethyl)-3-methylpentanedioate |
|---|---|
| PubChem CID | 172697664 |
| Molecular Formula | C10H14N4Na2O4 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | disodium;2,2-diamino-4-(1H-imidazol-5-ylmethyl)-3-methylpentanedioate |
| SMILES | CC(C(Cc1cnc[nH]1)C(=O)[O-])C(N)(N)C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C10H16N4O4.2Na/c1-5(10(11,12)9(17)18)7(8(15)16)2-6-3-13-4-14-6;;/h3-5,7H,2,11-12H2,1H3,(H,13,14)(H,15,16)(H,17,18);;/q;2*+1/p-2 |
| InChIKey | CNOQKGQAKUAIFU-UHFFFAOYSA-L |
| XLogP | -9.67 |
| TPSA | 160.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | -9.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|