C29H44FN3O — CID 146643762
7a-cyclohexyl-4-fluoro-7-methyl-N-[3-[(1-methylpiperidin-3-yl)methyl]phenyl]-1,2,3,3a,4,5,6,7-octahydroindole-2-carboxamide (PubChem CID 146643762) has the molecular formula C29H44FN3O and a molecular weight of 469.69 g/mol. Its IUPAC name is 7a-cyclohexyl-4-fluoro-7-methyl-N-[3-[(1-methylpiperidin-3-yl)methyl]phenyl]-1,2,3,3a,4,5,6,7-octahydroindole-2-carboxamide.
| Compound Name | 7a-cyclohexyl-4-fluoro-7-methyl-N-[3-[(1-methylpiperidin-3-yl)methyl]phenyl]-1,2,3,3a,4,5,6,7-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 146643762 |
| Molecular Formula | C29H44FN3O |
| Molecular Weight | 469.69 g/mol |
| Exact Mass | 469.35 |
| IUPAC Name | 7a-cyclohexyl-4-fluoro-7-methyl-N-[3-[(1-methylpiperidin-3-yl)methyl]phenyl]-1,2,3,3a,4,5,6,7-octahydroindole-2-carboxamide |
| SMILES | CC1CCC(F)C2CC(C(=O)Nc3cccc(CC4CCCN(C)C4)c3)NC12C1CCCCC1 |
| InChI | InChI=1S/C29H44FN3O/c1-20-13-14-26(30)25-18-27(32-29(20,25)23-10-4-3-5-11-23)28(34)31-24-12-6-8-21(17-24)16-22-9-7-15-33(2)19-22/h6,8,12,17,20,22-23,25-27,32H,3-5,7,9-11,13-16,18-19H2,1-2H3,(H,31,34) |
| InChIKey | BCLBWIFLOSUEGL-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.69 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |