C16H25NO7 — CID 146643804
1-O-tert-butyl 3-O-methyl 4-(3-methoxy-3-oxopropanoyl)piperidine-1,3-dicarboxylate (PubChem CID 146643804) has the molecular formula C16H25NO7 and a molecular weight of 343.38 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl 4-(3-methoxy-3-oxopropanoyl)piperidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl 4-(3-methoxy-3-oxopropanoyl)piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 146643804 |
| Molecular Formula | C16H25NO7 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl 4-(3-methoxy-3-oxopropanoyl)piperidine-1,3-dicarboxylate |
| SMILES | COC(=O)CC(=O)C1CCN(C(=O)OC(C)(C)C)CC1C(=O)OC |
| InChI | InChI=1S/C16H25NO7/c1-16(2,3)24-15(21)17-7-6-10(11(9-17)14(20)23-5)12(18)8-13(19)22-4/h10-11H,6-9H2,1-5H3 |
| InChIKey | CMGHZJCPBBEZLT-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|