About S-propyl 4-methyl-3-methylidenehexanethioate
S-propyl 4-methyl-3-methylidenehexanethioate (PubChem CID 146646991) has the molecular formula C11H20OS
and a molecular weight of 200.35 g/mol. Its IUPAC name is S-propyl 4-methyl-3-methylidenehexanethioate.
Molecular Properties
| Compound Name | S-propyl 4-methyl-3-methylidenehexanethioate |
| PubChem CID | 146646991 |
| Molecular Formula | C11H20OS |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | S-propyl 4-methyl-3-methylidenehexanethioate |
| SMILES | C=C(CC(=O)SCCC)C(C)CC |
| InChI | InChI=1S/C11H20OS/c1-5-7-13-11(12)8-10(4)9(3)6-2/h9H,4-8H2,1-3H3 |
| InChIKey | XXNYQTGVKPTZCI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-propyl 4-methyl-3-methylidenehexanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-propyl 4-methyl-3-methylidenehexanethioate?
The IUPAC name of S-propyl 4-methyl-3-methylidenehexanethioate (CID 146646991) is S-propyl 4-methyl-3-methylidenehexanethioate.
What is the SMILES notation for S-propyl 4-methyl-3-methylidenehexanethioate?
The canonical SMILES for S-propyl 4-methyl-3-methylidenehexanethioate is C=C(CC(=O)SCCC)C(C)CC.
What is the InChIKey of S-propyl 4-methyl-3-methylidenehexanethioate?
The InChIKey is XXNYQTGVKPTZCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20OS/c1-5-7-13-11(12)8-10(4)9(3)6-2/h9H,4-8H2,1-3H3.
What are the key properties of S-propyl 4-methyl-3-methylidenehexanethioate?
S-propyl 4-methyl-3-methylidenehexanethioate has a molecular weight of 200.35 g/mol, XLogP of 3.65, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-propyl 4-methyl-3-methylidenehexanethioate is sourced from PubChem (CID 146646991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).