About S-(3-oxopent-4-enyl) 2-methylbutanethioate
S-(3-oxopent-4-enyl) 2-methylbutanethioate (PubChem CID 139751843) has the molecular formula C10H16O2S
and a molecular weight of 200.30 g/mol. Its IUPAC name is S-(3-oxopent-4-enyl) 2-methylbutanethioate.
Molecular Properties
| Compound Name | S-(3-oxopent-4-enyl) 2-methylbutanethioate |
| PubChem CID | 139751843 |
| Molecular Formula | C10H16O2S |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | S-(3-oxopent-4-enyl) 2-methylbutanethioate |
| SMILES | C=CC(=O)CCSC(=O)C(C)CC |
| InChI | InChI=1S/C10H16O2S/c1-4-8(3)10(12)13-7-6-9(11)5-2/h5,8H,2,4,6-7H2,1,3H3 |
| InChIKey | GKACDCXCNXLAPU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(3-oxopent-4-enyl) 2-methylbutanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(3-oxopent-4-enyl) 2-methylbutanethioate?
The IUPAC name of S-(3-oxopent-4-enyl) 2-methylbutanethioate (CID 139751843) is S-(3-oxopent-4-enyl) 2-methylbutanethioate.
What is the SMILES notation for S-(3-oxopent-4-enyl) 2-methylbutanethioate?
The canonical SMILES for S-(3-oxopent-4-enyl) 2-methylbutanethioate is C=CC(=O)CCSC(=O)C(C)CC.
What is the InChIKey of S-(3-oxopent-4-enyl) 2-methylbutanethioate?
The InChIKey is GKACDCXCNXLAPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2S/c1-4-8(3)10(12)13-7-6-9(11)5-2/h5,8H,2,4,6-7H2,1,3H3.
What are the key properties of S-(3-oxopent-4-enyl) 2-methylbutanethioate?
S-(3-oxopent-4-enyl) 2-methylbutanethioate has a molecular weight of 200.30 g/mol, XLogP of 2.44, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(3-oxopent-4-enyl) 2-methylbutanethioate is sourced from PubChem (CID 139751843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).