C20H34OS2 — CID 142809401
S-[2-[(3,5,7-trimethyl-1-adamantyl)sulfanyl]ethyl] 2-methylbutanethioate (PubChem CID 142809401) has the molecular formula C20H34OS2 and a molecular weight of 354.63 g/mol. Its IUPAC name is S-[2-[(3,5,7-trimethyl-1-adamantyl)sulfanyl]ethyl] 2-methylbutanethioate.
| Compound Name | S-[2-[(3,5,7-trimethyl-1-adamantyl)sulfanyl]ethyl] 2-methylbutanethioate |
|---|---|
| PubChem CID | 142809401 |
| Molecular Formula | C20H34OS2 |
| Molecular Weight | 354.63 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | S-[2-[(3,5,7-trimethyl-1-adamantyl)sulfanyl]ethyl] 2-methylbutanethioate |
| SMILES | CCC(C)C(=O)SCCSC12CC3(C)CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C20H34OS2/c1-6-15(2)16(21)22-7-8-23-20-12-17(3)9-18(4,13-20)11-19(5,10-17)14-20/h15H,6-14H2,1-5H3 |
| InChIKey | ASTSKRRUHMRXFU-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.63 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|