C14H26O — CID 143738791
3-methyl-4-[(1R)-1,2,2-triethylcyclopropyl]butan-2-one (PubChem CID 143738791) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is 3-methyl-4-[(1R)-1,2,2-triethylcyclopropyl]butan-2-one.
| Compound Name | 3-methyl-4-[(1R)-1,2,2-triethylcyclopropyl]butan-2-one |
|---|---|
| PubChem CID | 143738791 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 3-methyl-4-[(1R)-1,2,2-triethylcyclopropyl]butan-2-one |
| SMILES | CCC1(CC)C[C@@]1(CC)CC(C)C(C)=O |
| InChI | InChI=1S/C14H26O/c1-6-13(7-2)10-14(13,8-3)9-11(4)12(5)15/h11H,6-10H2,1-5H3/t11?,14-/m1/s1 |
| InChIKey | ZNCMMBLIIDYRRG-SBXXRYSUSA-N |
| XLogP | 4.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |