C50H40N4 — CID 146647292
N-[2-[[4-[1-(4,6-diphenylpyrimidin-2-yl)naphthalen-2-yl]phenyl]methyl]-1-phenylbutylidene]benzenecarboximidamide (PubChem CID 146647292) has the molecular formula C50H40N4 and a molecular weight of 696.90 g/mol. Its IUPAC name is N-[2-[[4-[1-(4,6-diphenylpyrimidin-2-yl)naphthalen-2-yl]phenyl]methyl]-1-phenylbutylidene]benzenecarboximidamide.
| Compound Name | N-[2-[[4-[1-(4,6-diphenylpyrimidin-2-yl)naphthalen-2-yl]phenyl]methyl]-1-phenylbutylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 146647292 |
| Molecular Formula | C50H40N4 |
| Molecular Weight | 696.90 g/mol |
| Exact Mass | 696.33 |
| IUPAC Name | N-[2-[[4-[1-(4,6-diphenylpyrimidin-2-yl)naphthalen-2-yl]phenyl]methyl]-1-phenylbutylidene]benzenecarboximidamide |
| SMILES | [H]/N=C(/N=C(\c1ccccc1)C(CC)Cc1ccc(-c2ccc3ccccc3c2-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)cc1)c1ccccc1 |
| InChI | InChI=1S/C50H40N4/c1-2-36(48(41-22-11-5-12-23-41)54-49(51)42-24-13-6-14-25-42)33-35-27-29-38(30-28-35)44-32-31-37-17-15-16-26-43(37)47(44)50-52-45(39-18-7-3-8-19-39)34-46(53-50)40-20-9-4-10-21-40/h3-32,34,36,51H,2,33H2,1H3/b51-49+,54-48- |
| InChIKey | CRMSIWIGTRHLAB-LMRHUKOHSA-N |
| XLogP | 12.38 |
| TPSA | 61.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.90 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|