C19H20ClFN2O — CID 146649079
(4R)-N-[3-chloro-4-(2-methylphenyl)phenyl]-4-fluoropiperidine-2-carboxamide (PubChem CID 146649079) has the molecular formula C19H20ClFN2O and a molecular weight of 346.83 g/mol. Its IUPAC name is (4R)-N-[3-chloro-4-(2-methylphenyl)phenyl]-4-fluoropiperidine-2-carboxamide.
| Compound Name | (4R)-N-[3-chloro-4-(2-methylphenyl)phenyl]-4-fluoropiperidine-2-carboxamide |
|---|---|
| PubChem CID | 146649079 |
| Molecular Formula | C19H20ClFN2O |
| Molecular Weight | 346.83 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (4R)-N-[3-chloro-4-(2-methylphenyl)phenyl]-4-fluoropiperidine-2-carboxamide |
| SMILES | Cc1ccccc1-c1ccc(NC(=O)C2C[C@H](F)CCN2)cc1Cl |
| InChI | InChI=1S/C19H20ClFN2O/c1-12-4-2-3-5-15(12)16-7-6-14(11-17(16)20)23-19(24)18-10-13(21)8-9-22-18/h2-7,11,13,18,22H,8-10H2,1H3,(H,23,24)/t13-,18?/m1/s1 |
| InChIKey | KFSMEKVXDOXXGD-YJJYDOSJSA-N |
| XLogP | 4.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.83 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |