C17H15ClF5N — CID 14664923
N-[(4-chlorophenyl)-(2,3,4,5,6-pentafluorophenyl)methyl]-N-ethylethanamine (PubChem CID 14664923) has the molecular formula C17H15ClF5N and a molecular weight of 363.76 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-(2,3,4,5,6-pentafluorophenyl)methyl]-N-ethylethanamine.
| Compound Name | N-[(4-chlorophenyl)-(2,3,4,5,6-pentafluorophenyl)methyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 14664923 |
| Molecular Formula | C17H15ClF5N |
| Molecular Weight | 363.76 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | N-[(4-chlorophenyl)-(2,3,4,5,6-pentafluorophenyl)methyl]-N-ethylethanamine |
| SMILES | CCN(CC)C(c1ccc(Cl)cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H15ClF5N/c1-3-24(4-2)17(9-5-7-10(18)8-6-9)11-12(19)14(21)16(23)15(22)13(11)20/h5-8,17H,3-4H2,1-2H3 |
| InChIKey | WTKBPFZNRFUCAK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.76 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|