C19H21N7O3S — CID 146651074
1,5-dimethyl-7-[(2-oxo-3H-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)amino]spiro[3H-pyrido[2,1-f][1,2,4]triazine-2,1'-cyclohexane]-4,8-dione (PubChem CID 146651074) has the molecular formula C19H21N7O3S and a molecular weight of 427.49 g/mol. Its IUPAC name is 1,5-dimethyl-7-[(2-oxo-3H-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)amino]spiro[3H-pyrido[2,1-f][1,2,4]triazine-2,1'-cyclohexane]-4,8-dione.
| Compound Name | 1,5-dimethyl-7-[(2-oxo-3H-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)amino]spiro[3H-pyrido[2,1-f][1,2,4]triazine-2,1'-cyclohexane]-4,8-dione |
|---|---|
| PubChem CID | 146651074 |
| Molecular Formula | C19H21N7O3S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 1,5-dimethyl-7-[(2-oxo-3H-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)amino]spiro[3H-pyrido[2,1-f][1,2,4]triazine-2,1'-cyclohexane]-4,8-dione |
| SMILES | Cc1cc(Nc2ncnc3[nH]c(=O)sc23)c(=O)n2c1C(=O)NC1(CCCCC1)N2C |
| InChI | InChI=1S/C19H21N7O3S/c1-10-8-11(22-14-13-15(21-9-20-14)23-18(29)30-13)17(28)26-12(10)16(27)24-19(25(26)2)6-4-3-5-7-19/h8-9H,3-7H2,1-2H3,(H,24,27)(H2,20,21,22,23,29) |
| InChIKey | VRFLXYFXGNVEQN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |