C18H19N7O2 — CID 146651036
1,5-dimethyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)spiro[3H-pyrido[2,1-f][1,2,4]triazine-2,1'-cyclobutane]-4,8-dione (PubChem CID 146651036) has the molecular formula C18H19N7O2 and a molecular weight of 365.40 g/mol. Its IUPAC name is 1,5-dimethyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)spiro[3H-pyrido[2,1-f][1,2,4]triazine-2,1'-cyclobutane]-4,8-dione.
| Compound Name | 1,5-dimethyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)spiro[3H-pyrido[2,1-f][1,2,4]triazine-2,1'-cyclobutane]-4,8-dione |
|---|---|
| PubChem CID | 146651036 |
| Molecular Formula | C18H19N7O2 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 1,5-dimethyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)spiro[3H-pyrido[2,1-f][1,2,4]triazine-2,1'-cyclobutane]-4,8-dione |
| SMILES | Cc1cc(Nc2ncnc3[nH]ccc23)c(=O)n2c1C(=O)NC1(CCC1)N2C |
| InChI | InChI=1S/C18H19N7O2/c1-10-8-12(22-15-11-4-7-19-14(11)20-9-21-15)17(27)25-13(10)16(26)23-18(24(25)2)5-3-6-18/h4,7-9H,3,5-6H2,1-2H3,(H,23,26)(H2,19,20,21,22) |
| InChIKey | UNCZQZUGXFEJQR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |