C26H24N8O3 — CID 146650647
N-[3-[5-methyl-4,8-dioxo-7-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)spiro[3H-pyrido[2,1-f][1,2,4]triazine-2,1'-cyclobutane]-1-yl]phenyl]prop-2-enamide (PubChem CID 146650647) has the molecular formula C26H24N8O3 and a molecular weight of 496.53 g/mol. Its IUPAC name is N-[3-[5-methyl-4,8-dioxo-7-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)spiro[3H-pyrido[2,1-f][1,2,4]triazine-2,1'-cyclobutane]-1-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[5-methyl-4,8-dioxo-7-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)spiro[3H-pyrido[2,1-f][1,2,4]triazine-2,1'-cyclobutane]-1-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146650647 |
| Molecular Formula | C26H24N8O3 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | N-[3-[5-methyl-4,8-dioxo-7-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)spiro[3H-pyrido[2,1-f][1,2,4]triazine-2,1'-cyclobutane]-1-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(N2n3c(c(C)cc(Nc4ncnc5[nH]ccc45)c3=O)C(=O)NC23CCC3)c1 |
| InChI | InChI=1S/C26H24N8O3/c1-3-20(35)30-16-6-4-7-17(13-16)34-26(9-5-10-26)32-24(36)21-15(2)12-19(25(37)33(21)34)31-23-18-8-11-27-22(18)28-14-29-23/h3-4,6-8,11-14H,1,5,9-10H2,2H3,(H,30,35)(H,32,36)(H2,27,28,29,31) |
| InChIKey | YKUWXLQHMXQHLY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 137.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|