C25H23FN6O — CID 146653460
4-[[4-[6-[2-(dimethylamino)ethylamino]-2-fluoro-3-pyridinyl]-1-oxophthalazin-2-yl]methyl]benzonitrile (PubChem CID 146653460) has the molecular formula C25H23FN6O and a molecular weight of 442.50 g/mol. Its IUPAC name is 4-[[4-[6-[2-(dimethylamino)ethylamino]-2-fluoro-3-pyridinyl]-1-oxophthalazin-2-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-[6-[2-(dimethylamino)ethylamino]-2-fluoro-3-pyridinyl]-1-oxophthalazin-2-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 146653460 |
| Molecular Formula | C25H23FN6O |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 4-[[4-[6-[2-(dimethylamino)ethylamino]-2-fluoro-3-pyridinyl]-1-oxophthalazin-2-yl]methyl]benzonitrile |
| SMILES | CN(C)CCNc1ccc(-c2nn(Cc3ccc(C#N)cc3)c(=O)c3ccccc23)c(F)n1 |
| InChI | InChI=1S/C25H23FN6O/c1-31(2)14-13-28-22-12-11-21(24(26)29-22)23-19-5-3-4-6-20(19)25(33)32(30-23)16-18-9-7-17(15-27)8-10-18/h3-12H,13-14,16H2,1-2H3,(H,28,29) |
| InChIKey | ZWGLKFFZPPEUPE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|