C25H19ClFN5O3 — CID 146653408
methyl 3-[[3-chloro-5-[3-[(4-cyanophenyl)methyl]-4-oxophthalazin-1-yl]-6-fluoro-2-pyridinyl]amino]propanoate (PubChem CID 146653408) has the molecular formula C25H19ClFN5O3 and a molecular weight of 491.91 g/mol. Its IUPAC name is methyl 3-[[3-chloro-5-[3-[(4-cyanophenyl)methyl]-4-oxophthalazin-1-yl]-6-fluoro-2-pyridinyl]amino]propanoate.
| Compound Name | methyl 3-[[3-chloro-5-[3-[(4-cyanophenyl)methyl]-4-oxophthalazin-1-yl]-6-fluoro-2-pyridinyl]amino]propanoate |
|---|---|
| PubChem CID | 146653408 |
| Molecular Formula | C25H19ClFN5O3 |
| Molecular Weight | 491.91 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | methyl 3-[[3-chloro-5-[3-[(4-cyanophenyl)methyl]-4-oxophthalazin-1-yl]-6-fluoro-2-pyridinyl]amino]propanoate |
| SMILES | COC(=O)CCNc1nc(F)c(-c2nn(Cc3ccc(C#N)cc3)c(=O)c3ccccc23)cc1Cl |
| InChI | InChI=1S/C25H19ClFN5O3/c1-35-21(33)10-11-29-24-20(26)12-19(23(27)30-24)22-17-4-2-3-5-18(17)25(34)32(31-22)14-16-8-6-15(13-28)7-9-16/h2-9,12H,10-11,14H2,1H3,(H,29,30) |
| InChIKey | SVSDKPANGJVNOJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.91 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|