C21H14FN5O — CID 146653861
4-[[4-(6-amino-2-fluoro-3-pyridinyl)-1-oxophthalazin-2-yl]methyl]benzonitrile (PubChem CID 146653861) has the molecular formula C21H14FN5O and a molecular weight of 371.38 g/mol. Its IUPAC name is 4-[[4-(6-amino-2-fluoro-3-pyridinyl)-1-oxophthalazin-2-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-(6-amino-2-fluoro-3-pyridinyl)-1-oxophthalazin-2-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 146653861 |
| Molecular Formula | C21H14FN5O |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 4-[[4-(6-amino-2-fluoro-3-pyridinyl)-1-oxophthalazin-2-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(Cn2nc(-c3ccc(N)nc3F)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C21H14FN5O/c22-20-17(9-10-18(24)25-20)19-15-3-1-2-4-16(15)21(28)27(26-19)12-14-7-5-13(11-23)6-8-14/h1-10H,12H2,(H2,24,25) |
| InChIKey | RVEPYLVPTLTJQE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 97.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|