C24H17ClFN5O3 — CID 146653463
3-[[3-chloro-5-[3-[(4-cyanophenyl)methyl]-4-oxophthalazin-1-yl]-6-fluoro-2-pyridinyl]amino]propanoic acid (PubChem CID 146653463) has the molecular formula C24H17ClFN5O3 and a molecular weight of 477.88 g/mol. Its IUPAC name is 3-[[3-chloro-5-[3-[(4-cyanophenyl)methyl]-4-oxophthalazin-1-yl]-6-fluoro-2-pyridinyl]amino]propanoic acid.
| Compound Name | 3-[[3-chloro-5-[3-[(4-cyanophenyl)methyl]-4-oxophthalazin-1-yl]-6-fluoro-2-pyridinyl]amino]propanoic acid |
|---|---|
| PubChem CID | 146653463 |
| Molecular Formula | C24H17ClFN5O3 |
| Molecular Weight | 477.88 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 3-[[3-chloro-5-[3-[(4-cyanophenyl)methyl]-4-oxophthalazin-1-yl]-6-fluoro-2-pyridinyl]amino]propanoic acid |
| SMILES | N#Cc1ccc(Cn2nc(-c3cc(Cl)c(NCCC(=O)O)nc3F)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C24H17ClFN5O3/c25-19-11-18(22(26)29-23(19)28-10-9-20(32)33)21-16-3-1-2-4-17(16)24(34)31(30-21)13-15-7-5-14(12-27)6-8-15/h1-8,11H,9-10,13H2,(H,28,29)(H,32,33) |
| InChIKey | PERAEMXMVFACJZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.88 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|