C24H20FN5O2 — CID 146653546
4-[[4-[2-fluoro-6-(2-methoxyethylamino)-3-pyridinyl]-1-oxophthalazin-2-yl]methyl]benzonitrile (PubChem CID 146653546) has the molecular formula C24H20FN5O2 and a molecular weight of 429.46 g/mol. Its IUPAC name is 4-[[4-[2-fluoro-6-(2-methoxyethylamino)-3-pyridinyl]-1-oxophthalazin-2-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-[2-fluoro-6-(2-methoxyethylamino)-3-pyridinyl]-1-oxophthalazin-2-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 146653546 |
| Molecular Formula | C24H20FN5O2 |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 4-[[4-[2-fluoro-6-(2-methoxyethylamino)-3-pyridinyl]-1-oxophthalazin-2-yl]methyl]benzonitrile |
| SMILES | COCCNc1ccc(-c2nn(Cc3ccc(C#N)cc3)c(=O)c3ccccc23)c(F)n1 |
| InChI | InChI=1S/C24H20FN5O2/c1-32-13-12-27-21-11-10-20(23(25)28-21)22-18-4-2-3-5-19(18)24(31)30(29-22)15-17-8-6-16(14-26)7-9-17/h2-11H,12-13,15H2,1H3,(H,27,28) |
| InChIKey | BPUCDJJRLUVBPR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|