C25H31N5O4 — CID 146654306
7-(1-but-2-ynoylpiperidin-4-yl)-2-(3,5-dimethoxy-4-methylphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 146654306) has the molecular formula C25H31N5O4 and a molecular weight of 465.55 g/mol. Its IUPAC name is 7-(1-but-2-ynoylpiperidin-4-yl)-2-(3,5-dimethoxy-4-methylphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 7-(1-but-2-ynoylpiperidin-4-yl)-2-(3,5-dimethoxy-4-methylphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 146654306 |
| Molecular Formula | C25H31N5O4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 7-(1-but-2-ynoylpiperidin-4-yl)-2-(3,5-dimethoxy-4-methylphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CC#CC(=O)N1CCC(C2CCNc3c(C(N)=O)c(-c4cc(OC)c(C)c(OC)c4)nn32)CC1 |
| InChI | InChI=1S/C25H31N5O4/c1-5-6-21(31)29-11-8-16(9-12-29)18-7-10-27-25-22(24(26)32)23(28-30(18)25)17-13-19(33-3)15(2)20(14-17)34-4/h13-14,16,18,27H,7-12H2,1-4H3,(H2,26,32) |
| InChIKey | AHMDZLBGZBQNJE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|