C31H48IN — CID 146659988
2-(2-iodopropan-2-yl)-5-[(2R)-2-[(5R,8R,9R,10S,13R,14S,17R)-3,3,13-trimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]pyridine (PubChem CID 146659988) has the molecular formula C31H48IN and a molecular weight of 561.64 g/mol. Its IUPAC name is 2-(2-iodopropan-2-yl)-5-[(2R)-2-[(5R,8R,9R,10S,13R,14S,17R)-3,3,13-trimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]pyridine.
| Compound Name | 2-(2-iodopropan-2-yl)-5-[(2R)-2-[(5R,8R,9R,10S,13R,14S,17R)-3,3,13-trimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]pyridine |
|---|---|
| PubChem CID | 146659988 |
| Molecular Formula | C31H48IN |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | 2-(2-iodopropan-2-yl)-5-[(2R)-2-[(5R,8R,9R,10S,13R,14S,17R)-3,3,13-trimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]pyridine |
| SMILES | C[C@H](Cc1ccc(C(C)(C)I)nc1)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4CC(C)(C)CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H48IN/c1-20(17-21-7-12-28(33-19-21)30(4,5)32)26-10-11-27-25-9-8-22-18-29(2,3)15-13-23(22)24(25)14-16-31(26,27)6/h7,12,19-20,22-27H,8-11,13-18H2,1-6H3/t20-,22-,23+,24-,25-,26-,27+,31-/m1/s1 |
| InChIKey | KOPUHGYWYDIMEM-JKVMKLMCSA-N |
| XLogP | 9.23 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|