C23H21ClF2N6 — CID 146661722
6-[5-(5-chloro-2,4-difluorophenyl)-1H-pyrazol-4-yl]-N-(piperidin-2-ylmethyl)-1,5-naphthyridin-3-amine (PubChem CID 146661722) has the molecular formula C23H21ClF2N6 and a molecular weight of 454.91 g/mol. Its IUPAC name is 6-[5-(5-chloro-2,4-difluorophenyl)-1H-pyrazol-4-yl]-N-(piperidin-2-ylmethyl)-1,5-naphthyridin-3-amine.
| Compound Name | 6-[5-(5-chloro-2,4-difluorophenyl)-1H-pyrazol-4-yl]-N-(piperidin-2-ylmethyl)-1,5-naphthyridin-3-amine |
|---|---|
| PubChem CID | 146661722 |
| Molecular Formula | C23H21ClF2N6 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 6-[5-(5-chloro-2,4-difluorophenyl)-1H-pyrazol-4-yl]-N-(piperidin-2-ylmethyl)-1,5-naphthyridin-3-amine |
| SMILES | Fc1cc(F)c(-c2[nH]ncc2-c2ccc3ncc(NCC4CCCCN4)cc3n2)cc1Cl |
| InChI | InChI=1S/C23H21ClF2N6/c24-17-8-15(18(25)9-19(17)26)23-16(12-30-32-23)20-4-5-21-22(31-20)7-14(11-29-21)28-10-13-3-1-2-6-27-13/h4-5,7-9,11-13,27-28H,1-3,6,10H2,(H,30,32) |
| InChIKey | OXSOHYUGSAUMID-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|