C16H17NO4S — CID 146662330
(2,6-dioxo-4-phenylcyclohexylidene)methyl 2-amino-3-sulfanylpropanoate (PubChem CID 146662330) has the molecular formula C16H17NO4S and a molecular weight of 319.38 g/mol. Its IUPAC name is (2,6-dioxo-4-phenylcyclohexylidene)methyl 2-amino-3-sulfanylpropanoate.
| Compound Name | (2,6-dioxo-4-phenylcyclohexylidene)methyl 2-amino-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 146662330 |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | (2,6-dioxo-4-phenylcyclohexylidene)methyl 2-amino-3-sulfanylpropanoate |
| SMILES | NC(CS)C(=O)OC=C1C(=O)CC(c2ccccc2)CC1=O |
| InChI | InChI=1S/C16H17NO4S/c17-13(9-22)16(20)21-8-12-14(18)6-11(7-15(12)19)10-4-2-1-3-5-10/h1-5,8,11,13,22H,6-7,9,17H2/b12-8- |
| InChIKey | RARDKGINVJAJCY-WQLSENKSSA-N |
| XLogP | 1.39 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|