C13H18FN3O4 — CID 146662629
tert-butyl N-[2-fluoro-3-oxo-3-[(4-oxo-1H-pyridin-3-yl)amino]propyl]carbamate (PubChem CID 146662629) has the molecular formula C13H18FN3O4 and a molecular weight of 299.30 g/mol. Its IUPAC name is tert-butyl N-[2-fluoro-3-oxo-3-[(4-oxo-1H-pyridin-3-yl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[2-fluoro-3-oxo-3-[(4-oxo-1H-pyridin-3-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 146662629 |
| Molecular Formula | C13H18FN3O4 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | tert-butyl N-[2-fluoro-3-oxo-3-[(4-oxo-1H-pyridin-3-yl)amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(F)C(=O)Nc1c[nH]ccc1=O |
| InChI | InChI=1S/C13H18FN3O4/c1-13(2,3)21-12(20)16-6-8(14)11(19)17-9-7-15-5-4-10(9)18/h4-5,7-8H,6H2,1-3H3,(H,15,18)(H,16,20)(H,17,19) |
| InChIKey | YHDJRYVRBXCRCY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |