C12H20N4O3 — CID 116849478
tert-butyl N-[2-(2-methylhydrazinyl)-2-oxo-1-(1H-pyrrol-3-yl)ethyl]carbamate (PubChem CID 116849478) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is tert-butyl N-[2-(2-methylhydrazinyl)-2-oxo-1-(1H-pyrrol-3-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-methylhydrazinyl)-2-oxo-1-(1H-pyrrol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 116849478 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | tert-butyl N-[2-(2-methylhydrazinyl)-2-oxo-1-(1H-pyrrol-3-yl)ethyl]carbamate |
| SMILES | CNNC(=O)C(NC(=O)OC(C)(C)C)c1cc[nH]c1 |
| InChI | InChI=1S/C12H20N4O3/c1-12(2,3)19-11(18)15-9(10(17)16-13-4)8-5-6-14-7-8/h5-7,9,13-14H,1-4H3,(H,15,18)(H,16,17) |
| InChIKey | IRTJMLFCXJPEKD-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|