C14H23N3O2 — CID 116861036
tert-butyl N-[2-(cyclopropylamino)-1-(1H-pyrrol-3-yl)ethyl]carbamate (PubChem CID 116861036) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is tert-butyl N-[2-(cyclopropylamino)-1-(1H-pyrrol-3-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(cyclopropylamino)-1-(1H-pyrrol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 116861036 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | tert-butyl N-[2-(cyclopropylamino)-1-(1H-pyrrol-3-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CNC1CC1)c1cc[nH]c1 |
| InChI | InChI=1S/C14H23N3O2/c1-14(2,3)19-13(18)17-12(9-16-11-4-5-11)10-6-7-15-8-10/h6-8,11-12,15-16H,4-5,9H2,1-3H3,(H,17,18) |
| InChIKey | YMKQNRFMNDYEMA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |