C14H19FINO2 — CID 146670025
2-fluoro-3-iodo-6-methoxy-N,N-di(propan-2-yl)benzamide (PubChem CID 146670025) has the molecular formula C14H19FINO2 and a molecular weight of 379.21 g/mol. Its IUPAC name is 2-fluoro-3-iodo-6-methoxy-N,N-di(propan-2-yl)benzamide.
| Compound Name | 2-fluoro-3-iodo-6-methoxy-N,N-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 146670025 |
| Molecular Formula | C14H19FINO2 |
| Molecular Weight | 379.21 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 2-fluoro-3-iodo-6-methoxy-N,N-di(propan-2-yl)benzamide |
| SMILES | COc1ccc(I)c(F)c1C(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C14H19FINO2/c1-8(2)17(9(3)4)14(18)12-11(19-5)7-6-10(16)13(12)15/h6-9H,1-5H3 |
| InChIKey | QVOMUJWRPVLPQX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.21 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|