C45H40N4S — CID 146670225
(4-cyclohexa-1,3-dien-1-yl-2-cyclohexa-1,5-dien-1-yl-1,2,3,4-tetrahydro-1,3,5-triazin-6-yl)-diphenyl-(9-phenylcarbazol-3-yl)-λ4-sulfane (PubChem CID 146670225) has the molecular formula C45H40N4S and a molecular weight of 668.91 g/mol. Its IUPAC name is (4-cyclohexa-1,3-dien-1-yl-2-cyclohexa-1,5-dien-1-yl-1,2,3,4-tetrahydro-1,3,5-triazin-6-yl)-diphenyl-(9-phenylcarbazol-3-yl)-λ4-sulfane.
| Compound Name | (4-cyclohexa-1,3-dien-1-yl-2-cyclohexa-1,5-dien-1-yl-1,2,3,4-tetrahydro-1,3,5-triazin-6-yl)-diphenyl-(9-phenylcarbazol-3-yl)-λ4-sulfane |
|---|---|
| PubChem CID | 146670225 |
| Molecular Formula | C45H40N4S |
| Molecular Weight | 668.91 g/mol |
| Exact Mass | 668.30 |
| IUPAC Name | (4-cyclohexa-1,3-dien-1-yl-2-cyclohexa-1,5-dien-1-yl-1,2,3,4-tetrahydro-1,3,5-triazin-6-yl)-diphenyl-(9-phenylcarbazol-3-yl)-λ4-sulfane |
| SMILES | C1=CCCC(C2N=C(S(c3ccccc3)(c3ccccc3)c3ccc4c(c3)c3ccccc3n4-c3ccccc3)NC(C3=CCCC=C3)N2)=C1 |
| InChI | InChI=1S/C45H40N4S/c1-6-18-33(19-7-1)43-46-44(34-20-8-2-9-21-34)48-45(47-43)50(36-24-12-4-13-25-36,37-26-14-5-15-27-37)38-30-31-42-40(32-38)39-28-16-17-29-41(39)49(42)35-22-10-3-11-23-35/h1,3-6,8,10-18,20-32,43-44,46H,2,7,9,19H2,(H,47,48) |
| InChIKey | MTGIYUFVYXBJLE-UHFFFAOYSA-N |
| XLogP | 10.82 |
| TPSA | 41.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.91 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |