C44H36N6 — CID 166750479
5-[5-(2-cyclohexa-1,5-dien-1-yl-6-phenyl-1,2,3,4-tetrahydro-1,3,5-triazin-4-yl)-1,2-dihydropyridin-2-yl]-7-phenylindolo[2,3-b]carbazole (PubChem CID 166750479) has the molecular formula C44H36N6 and a molecular weight of 648.81 g/mol. Its IUPAC name is 5-[5-(2-cyclohexa-1,5-dien-1-yl-6-phenyl-1,2,3,4-tetrahydro-1,3,5-triazin-4-yl)-1,2-dihydropyridin-2-yl]-7-phenylindolo[2,3-b]carbazole.
| Compound Name | 5-[5-(2-cyclohexa-1,5-dien-1-yl-6-phenyl-1,2,3,4-tetrahydro-1,3,5-triazin-4-yl)-1,2-dihydropyridin-2-yl]-7-phenylindolo[2,3-b]carbazole |
|---|---|
| PubChem CID | 166750479 |
| Molecular Formula | C44H36N6 |
| Molecular Weight | 648.81 g/mol |
| Exact Mass | 648.30 |
| IUPAC Name | 5-[5-(2-cyclohexa-1,5-dien-1-yl-6-phenyl-1,2,3,4-tetrahydro-1,3,5-triazin-4-yl)-1,2-dihydropyridin-2-yl]-7-phenylindolo[2,3-b]carbazole |
| SMILES | C1=CC(C2NC(c3ccccc3)=NC(C3=CNC(n4c5ccccc5c5cc6c7ccccc7n(-c7ccccc7)c6cc54)C=C3)N2)=CCC1 |
| InChI | InChI=1S/C44H36N6/c1-4-14-29(15-5-1)42-46-43(30-16-6-2-7-17-30)48-44(47-42)31-24-25-41(45-28-31)50-38-23-13-11-21-34(38)36-26-35-33-20-10-12-22-37(33)49(39(35)27-40(36)50)32-18-8-3-9-19-32/h1,3-6,8-28,41,43-45,48H,2,7H2,(H,46,47) |
| InChIKey | MJTUWDXRFZSQFL-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 58.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.81 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |