C38H33N5 — CID 146390190
9-[5-(2,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-4-yl)-1,2-dihydropyridin-2-yl]-2-phenyl-3,4-dihydrocarbazole (PubChem CID 146390190) has the molecular formula C38H33N5 and a molecular weight of 559.72 g/mol. Its IUPAC name is 9-[5-(2,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-4-yl)-1,2-dihydropyridin-2-yl]-2-phenyl-3,4-dihydrocarbazole.
| Compound Name | 9-[5-(2,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-4-yl)-1,2-dihydropyridin-2-yl]-2-phenyl-3,4-dihydrocarbazole |
|---|---|
| PubChem CID | 146390190 |
| Molecular Formula | C38H33N5 |
| Molecular Weight | 559.72 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | 9-[5-(2,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-4-yl)-1,2-dihydropyridin-2-yl]-2-phenyl-3,4-dihydrocarbazole |
| SMILES | C1=CC(n2c3c(c4ccccc42)CCC(c2ccccc2)=C3)NC=C1C1N=C(c2ccccc2)NC(c2ccccc2)N1 |
| InChI | InChI=1S/C38H33N5/c1-4-12-26(13-5-1)29-20-22-32-31-18-10-11-19-33(31)43(34(32)24-29)35-23-21-30(25-39-35)38-41-36(27-14-6-2-7-15-27)40-37(42-38)28-16-8-3-9-17-28/h1-19,21,23-25,35-36,38-39,41H,20,22H2,(H,40,42) |
| InChIKey | QVRYNFLXXSTMFW-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 53.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.72 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |