C11H13NO — CID 146675162
(3S,6R)-3-methyl-6-phenyl-3,6-dihydro-2H-1,4-oxazine (PubChem CID 146675162) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is (3S,6R)-3-methyl-6-phenyl-3,6-dihydro-2H-1,4-oxazine.
| Compound Name | (3S,6R)-3-methyl-6-phenyl-3,6-dihydro-2H-1,4-oxazine |
|---|---|
| PubChem CID | 146675162 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | (3S,6R)-3-methyl-6-phenyl-3,6-dihydro-2H-1,4-oxazine |
| SMILES | C[C@H]1CO[C@H](c2ccccc2)C=N1 |
| InChI | InChI=1S/C11H13NO/c1-9-8-13-11(7-12-9)10-5-3-2-4-6-10/h2-7,9,11H,8H2,1H3/t9-,11-/m0/s1 |
| InChIKey | QTYHJXFOYPSSBA-ONGXEEELSA-N |
| XLogP | 2.22 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |