C17H29Cl2FN2 — CID 146675492
1-[(4-fluorophenyl)methyl]-2-propan-2-yl-5-propylpiperazine;dihydrochloride (PubChem CID 146675492) has the molecular formula C17H29Cl2FN2 and a molecular weight of 351.34 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-2-propan-2-yl-5-propylpiperazine;dihydrochloride.
| Compound Name | 1-[(4-fluorophenyl)methyl]-2-propan-2-yl-5-propylpiperazine;dihydrochloride |
|---|---|
| PubChem CID | 146675492 |
| Molecular Formula | C17H29Cl2FN2 |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-2-propan-2-yl-5-propylpiperazine;dihydrochloride |
| SMILES | CCCC1CN(Cc2ccc(F)cc2)C(C(C)C)CN1.Cl.Cl |
| InChI | InChI=1S/C17H27FN2.2ClH/c1-4-5-16-12-20(17(10-19-16)13(2)3)11-14-6-8-15(18)9-7-14;;/h6-9,13,16-17,19H,4-5,10-12H2,1-3H3;2*1H |
| InChIKey | LQWZJFORNCOWAK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |